CAS 89894-30-4 is the registry number for 5-(4-Chlorophenyl)-1,2,4-thiadiazol-3-amine, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(4-chlorophenyl)-1,2,4-thiadiazol-3-amine (CAS 89894-30-4) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,2,4-thiadiazol-3-amine. InChIKey: XVSZVIZTUWVCFL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,2,4-thiadiazol-3-amine |
| InChIKey | XVSZVIZTUWVCFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NS2)N)Cl |
Computed by PubChem (NCBI)