CAS 1539779-80-0 is the registry number for 4-(3-Chlorophenyl)-1,2,3-thiadiazol-5-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
4-(3-chlorophenyl)thiadiazol-5-amine (CAS 1539779-80-0) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 4-(3-chlorophenyl)thiadiazol-5-amine. InChIKey: HBQVATDPFJLGFU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(3-chlorophenyl)thiadiazol-5-amine |
| InChIKey | HBQVATDPFJLGFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=C(SN=N2)N |
Computed by PubChem (NCBI)