Products 352328-41-7
CAS 352328-41-7 appears in our catalog under these names: 7-Chloro-2-(methylthio)pyrido[2,3-d]pyrimidine, 95%, 7-Chloro-2-(methylthio)pyrido(2,3-d)pyrimidine, 95%, 7-Chloro-2-(methylthio)pyrido[2,3-d]pyrimidine, 97%, 97%, 7-CHLORO-2-(METHYLTHIO)PYRIDO[2,3-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine (CAS 352328-41-7) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine. InChIKey: UNAVSLNMFZKAMD-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine |
| InChIKey | UNAVSLNMFZKAMD-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C=CC(=NC2=N1)Cl |
Computed by PubChem (NCBI)