Products 1578245-95-0
CAS 1578245-95-0 appears in our catalog under these names: 8-Chloro-2-(methylthio)pyrido[3,4-d]pyrimidine, 95%, 8–Chloro–2–(methylthio)pyrido(3，4–d)pyrimidine, 8-Chloro-2-(methylthio)pyrido[3,4-d]pyrimidine 97%, 8-Chloro-2-(methylsulfanyl)pyrido[3,4-d]pyrimidine, 97%, 97%, 8-CHLORO-2-(METHYLTHIO)PYRIDO[3,4-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine (CAS 1578245-95-0) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine. InChIKey: QMICGHGYKZQSQO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine |
| InChIKey | QMICGHGYKZQSQO-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C=CN=C(C2=N1)Cl |
Computed by PubChem (NCBI)