CAS 117320-61-3 is the registry number for 5-(3-Chlorophenyl)-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
5-(3-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 117320-61-3) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: NTQZVPQAJQHJLJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | NTQZVPQAJQHJLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)