CAS 388088-77-5 appears in our catalog under these names: 4-(4-Chlorophenyl)-1,2,3-thiadiazol-5-amine, 98%, 4-(4-Chlorophenyl)-1,2,3-thiadiazol-5-amine, 97%, 97%, 4-(4-Chlorophenyl)-1,2,3-thiadiazol-5-amine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
4-(4-chlorophenyl)thiadiazol-5-amine (CAS 388088-77-5) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 4-(4-chlorophenyl)thiadiazol-5-amine. InChIKey: CWWWFWUOEYNACY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(4-chlorophenyl)thiadiazol-5-amine |
| InChIKey | CWWWFWUOEYNACY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SN=N2)N)Cl |
Computed by PubChem (NCBI)