CAS 66297-55-0 appears in our catalog under these names: 4-(3-Chlorophenyl)-4h-1,2,4-triazole-3-thiol, 95%, 4-(3-Chlorophenyl)-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione (CAS 66297-55-0) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: BUJPRPNYDPDHJB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | BUJPRPNYDPDHJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C=NNC2=S |
Computed by PubChem (NCBI)