3-(Benzyloxy)-2,4-difluorobenzoic acid, 98%
cas: 1637224-62-4 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-2,4-difluorobenzoic acid, 98% (CAS 1637224-62-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1639441-25g |
| cas | 1637224-62-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 21989.17 Pln | |
| AmBeed | 10g | 11241.16 Pln | |
| AmBeed | 5g | 6671.14 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-difluoro-3-phenylmethoxybenzoic acid (CAS 1637224-62-4) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,4-difluoro-3-phenylmethoxybenzoic acid. InChIKey: PNHXVTHBYVKSGN-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,4-difluoro-3-phenylmethoxybenzoic acid |
| InChIKey | PNHXVTHBYVKSGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)C(=O)O)F |
Computed by PubChem (NCBI)