cas: 238428-26-7 — see every product listed under this CAS number, including other names
3-(Methylsulfonylamino)benzylamine, HCl, 97%, 97% (CAS 238428-26-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114I06-100mg |
| cas | 238428-26-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1403.60 Pln | |
| Chemat | 10g | 2306.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride (CAS 238428-26-7) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride. InChIKey: QRQYQHPUXNPLOG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride |
| InChIKey | QRQYQHPUXNPLOG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)