cas: 238428-26-7 — see every product listed under this CAS number, including other names
N-[3-(aminomethyl)phenyl]methanesulfonamide hydrochloride, 97% (CAS 238428-26-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F369616-250MG |
| cas | 238428-26-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 5g | 2861.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride (CAS 238428-26-7) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride. InChIKey: QRQYQHPUXNPLOG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride |
| InChIKey | QRQYQHPUXNPLOG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)