CAS 178752-79-9 appears in our catalog under these names: 3-(N,N-Dimethylamino)phenylboronic Acid, 3–(N,N–Dimethylamino)phenylboronic Acid(contains varying amounts of Anhydride), 3-(N,N-Dimethylamino)phenylboronic acid/ 95+%, 3-(Dimethylamino)phenylboronic acid, 95%, 3-(N,N-Dimethylamino)phenylboronic acid, 96%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
[3-(dimethylamino)phenyl]boronic acid (CAS 178752-79-9) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: [3-(dimethylamino)phenyl]boronic acid. InChIKey: YZQQHZXHCXAJAV-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | [3-(dimethylamino)phenyl]boronic acid |
| InChIKey | YZQQHZXHCXAJAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)