CAS 849066-63-3 appears in our catalog under these names: 3-Methyl-5-(5-methylisoxazol-3-yl)isoxazole-4-carboxylic acid, 98%, 3-Methyl-5-(5-methylisoxazol-3-yl)isoxazole-4-carboxylic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg.
3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid (CAS 849066-63-3) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid. InChIKey: ASBPDKJMOPNMLF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | ASBPDKJMOPNMLF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)C2=C(C(=NO2)C)C(=O)O |
Computed by PubChem (NCBI)