cas: 6946-22-1 — see every product listed under this CAS number, including other names
3-AMINOPHTHALIC ACID HYDROCHLORIDE, 98%, 98% (CAS 6946-22-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147PD-1g |
| cas | 6946-22-1 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-aminophthalic acid;hydrochloride (CAS 6946-22-1) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 3-aminophthalic acid;hydrochloride. InChIKey: ZBZAVEORKXFUQB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 3-aminophthalic acid;hydrochloride |
| InChIKey | ZBZAVEORKXFUQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)C(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)