cas: 6946-22-1 — see every product listed under this CAS number, including other names
3-Aminophthalic acid hydrochloride, 98% (CAS 6946-22-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222695-5G |
| cas | 6946-22-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 435.28 Pln | |
| Fluorochem | 500g | 1747.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-aminophthalic acid;hydrochloride (CAS 6946-22-1) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 3-aminophthalic acid;hydrochloride. InChIKey: ZBZAVEORKXFUQB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 3-aminophthalic acid;hydrochloride |
| InChIKey | ZBZAVEORKXFUQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)C(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)