3-Aminothiophene Oxalate, 95%
cas: 478149-05-2 — see every product listed under this CAS number, including other names
3-Aminothiophene Oxalate, 95% (CAS 478149-05-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A140424-1g |
| cas | 478149-05-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 370.38 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 1115.75 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 397.66 Pln | |
| BLDpharm | 10g | 636.47 Pln | |
| BLDpharm | 25g | 1197.38 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 458.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Oxalic acid;thiophen-3-amine (CAS 478149-05-2) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: oxalic acid;thiophen-3-amine. InChIKey: XBLAYFVCUPTTOI-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | oxalic acid;thiophen-3-amine |
| InChIKey | XBLAYFVCUPTTOI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
