CAS 496020-58-7 is the registry number for 2-(5-Methyl-2,4-dioxothiazolidin-5-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-methyl-2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid (CAS 496020-58-7) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 2-(5-methyl-2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid. InChIKey: CPSUMNMDBDCKMX-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 2-(5-methyl-2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid |
| InChIKey | CPSUMNMDBDCKMX-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)S1)CC(=O)O |
Computed by PubChem (NCBI)