Products 496020-58-7

CAS 496020-58-7 is the registry number for 2-(5-Methyl-2,4-dioxothiazolidin-5-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-methyl-2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid (CAS 496020-58-7) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 2-(5-methyl-2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid. InChIKey: CPSUMNMDBDCKMX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO4S
Molecular weight189.19 g/mol
IUPAC name2-(5-methyl-2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid
InChIKeyCPSUMNMDBDCKMX-UHFFFAOYSA-N
SMILESCC1(C(=O)NC(=O)S1)CC(=O)O

Computed by PubChem (NCBI)