Products 1368085-26-0
CAS 1368085-26-0 appears in our catalog under these names: 5-Methanesulfonyl-1H-pyrrole-2-carboxylic acid, 95%, 5-Methanesulfonyl-1H-pyrrole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methylsulfonyl-1H-pyrrole-2-carboxylic acid (CAS 1368085-26-0) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 5-methylsulfonyl-1H-pyrrole-2-carboxylic acid. InChIKey: OOYWEECLLQOIBG-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 5-methylsulfonyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | OOYWEECLLQOIBG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(N1)C(=O)O |
Computed by PubChem (NCBI)