CAS 49629-36-9 is the registry number for 3–(2,4–Dioxo–1,3–thiazolidin–3–yl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg.
3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoic acid (CAS 49629-36-9) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoic acid. InChIKey: FRPAVHFNOFSNDR-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-thiazolidin-3-yl)propanoic acid |
| InChIKey | FRPAVHFNOFSNDR-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CCC(=O)O |
Computed by PubChem (NCBI)