CAS 861965-63-1 appears in our catalog under these names: 3-Thiophenamine oxalate, 97%, Thiophen-3-amine oxalate, 97%, Thiophen–3–amine oxalate, Thiophen-3-amine oxalate, 3-Thiophenamine, ethanedioate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 500g, 25g, 5g, 100g, 1g, 250g, 10g.
Oxalic acid;thiophen-3-amine (CAS 861965-63-1) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: oxalic acid;thiophen-3-amine. InChIKey: XBLAYFVCUPTTOI-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | oxalic acid;thiophen-3-amine |
| InChIKey | XBLAYFVCUPTTOI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)