Products 2773465-25-9

CAS 2773465-25-9 is the registry number for 5-(S-Methylsulfonimidoyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(methylsulfonimidoyl)furan-2-carboxylic acid (CAS 2773465-25-9) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 5-(methylsulfonimidoyl)furan-2-carboxylic acid. InChIKey: PSLCBHUULPMFQH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO4S
Molecular weight189.19 g/mol
IUPAC name5-(methylsulfonimidoyl)furan-2-carboxylic acid
InChIKeyPSLCBHUULPMFQH-UHFFFAOYSA-N
SMILESCS(=N)(=O)C1=CC=C(O1)C(=O)O

Computed by PubChem (NCBI)