CAS 2773465-25-9 is the registry number for 5-(S-Methylsulfonimidoyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(methylsulfonimidoyl)furan-2-carboxylic acid (CAS 2773465-25-9) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 5-(methylsulfonimidoyl)furan-2-carboxylic acid. InChIKey: PSLCBHUULPMFQH-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 5-(methylsulfonimidoyl)furan-2-carboxylic acid |
| InChIKey | PSLCBHUULPMFQH-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)