CAS 83923-11-9 is the registry number for Lanthionine Ketimine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(3R)-3,6-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid (CAS 83923-11-9) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: (3R)-3,6-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid. InChIKey: XIVVIYYWXOMYOD-VKHMYHEASA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | (3R)-3,6-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid |
| InChIKey | XIVVIYYWXOMYOD-VKHMYHEASA-N |
| SMILES | C1[C@H](N=C(CS1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)