Products 66621-35-0
CAS 66621-35-0 appears in our catalog under these names: 2-Amino-6-hydroxybenzenesulfonic acid, 95%, 2-Amino-6-hydroxybenzenesulfonic acid, 95+%, 2–Amino–6–hydroxybenzenesulfonic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2-amino-6-hydroxybenzenesulfonic acid (CAS 66621-35-0) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 2-amino-6-hydroxybenzenesulfonic acid. InChIKey: RSWBDNVBJPQFAN-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 2-amino-6-hydroxybenzenesulfonic acid |
| InChIKey | RSWBDNVBJPQFAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)