CAS 478149-05-2 appears in our catalog under these names: 3–Aminothiophene Oxalate, 3-Aminothiophene Oxalate, 95%, 95%, Thiophen-3-amine oxalate, 95%, 3-Aminothiophene Oxalate, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
Oxalic acid;thiophen-3-amine (CAS 478149-05-2) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: oxalic acid;thiophen-3-amine. InChIKey: XBLAYFVCUPTTOI-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | oxalic acid;thiophen-3-amine |
| InChIKey | XBLAYFVCUPTTOI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)