cas: 579-18-0 — see every product listed under this CAS number, including other names
3-Benzoylbenzoic acid, 98%, 98% (CAS 579-18-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IYF-250mg |
| cas | 579-18-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 539.60 Pln | |
| Chemat | 25g | 1946.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-benzoylbenzoic acid (CAS 579-18-0) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-benzoylbenzoic acid. InChIKey: AXJXRLHTQQONQR-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-benzoylbenzoic acid |
| InChIKey | AXJXRLHTQQONQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)