cas: 2092564-68-4 — see every product listed under this CAS number, including other names
3-Bromo-2-fluoro-5-(trifluoromethyl)benzyl alcohol, ≥95%, ≥95% (CAS 2092564-68-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12W00Z-1g |
| cas | 2092564-68-4 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1293.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]methanol (CAS 2092564-68-4) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: [3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]methanol. InChIKey: WMVAVELEYDTMRF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | [3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | WMVAVELEYDTMRF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)F)Br)C(F)(F)F |
Computed by PubChem (NCBI)