3-Bromo-5-Chlorobenzoyl chloride, 95%
cas: 21900-27-6 — see every product listed under this CAS number, including other names
3-Bromo-5-Chlorobenzoyl chloride, 95% (CAS 21900-27-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A801139-100mg |
| cas | 21900-27-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2389.56 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 408.77 Pln | |
| BLDpharm | 1g | 891.93 Pln | |
| BLDpharm | 5g | 2569.12 Pln | |
| Fluorochem | 250mg | 679.99 Pln | |
| Fluorochem | 1g | 1549.47 Pln | |
| Fluorochem | 5g | 4433.87 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-5-chlorobenzoyl chloride (CAS 21900-27-6) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 3-bromo-5-chlorobenzoyl chloride. InChIKey: AFMZOCJLKKONRO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 3-bromo-5-chlorobenzoyl chloride |
| InChIKey | AFMZOCJLKKONRO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(=O)Cl |
Computed by PubChem (NCBI)