CAS 120077-80-7 appears in our catalog under these names: 4-Bromo-3,5-dichlorobenzaldehyde, 95%, 4-Bromo-3,5-dichlorobenzaldehyde, 98%, 98%, 4-Bromo-3,5-dichlorobenzaldehyde, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.
4-bromo-3,5-dichlorobenzaldehyde (CAS 120077-80-7) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 4-bromo-3,5-dichlorobenzaldehyde. InChIKey: RTAOUCJQYRVMJD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 4-bromo-3,5-dichlorobenzaldehyde |
| InChIKey | RTAOUCJQYRVMJD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Br)Cl)C=O |
Computed by PubChem (NCBI)