CAS 1349716-93-3 appears in our catalog under these names: 4-Bromo-2,5-dichlorobenzaldehyde, 95%, 4-Bromo-2,5-dichlorobenzaldehyde, 90%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
4-bromo-2,5-dichlorobenzaldehyde (CAS 1349716-93-3) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 4-bromo-2,5-dichlorobenzaldehyde. InChIKey: OTZMLLOKGOGAGO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 4-bromo-2,5-dichlorobenzaldehyde |
| InChIKey | OTZMLLOKGOGAGO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)Cl)C=O |
Computed by PubChem (NCBI)