CAS 21900-52-7 appears in our catalog under these names: Dapagliflozin Impurity 55, 5-Bromo-2-chlorobenzoyl Chloride, 5-Bromo-2-chloro-benzoyl chloride, 97%. Offered by: Chemat Brand, TRC, Biosynth, Fluorochem, Ambeed. Available pack sizes: on request, 1g, 250mg, 500mg, 100g, 50g, 250g, 500g.
5-bromo-2-chlorobenzoyl chloride (CAS 21900-52-7) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 5-bromo-2-chlorobenzoyl chloride. InChIKey: TZIQQJRRMJWMDI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 5-bromo-2-chlorobenzoyl chloride |
| InChIKey | TZIQQJRRMJWMDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)Cl)Cl |
Computed by PubChem (NCBI)