Products 21900-32-3

CAS 21900-32-3 appears in our catalog under these names: 4-Bromo-3-chlorobenzoyl chloride, 4-Bromo-3-chlorobenzoyl chloride, 95%, 4-Bromo-3-chlorobenzoyl chloride, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-bromo-3-chlorobenzoyl chloride (CAS 21900-32-3) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 4-bromo-3-chlorobenzoyl chloride. InChIKey: OEFADALRZHTONM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrCl2O
Molecular weight253.90 g/mol
IUPAC name4-bromo-3-chlorobenzoyl chloride
InChIKeyOEFADALRZHTONM-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)Cl)Cl)Br

Computed by PubChem (NCBI)