CAS 116529-65-8 appears in our catalog under these names: 2-Bromo-6-chlorobenzoyl chloride, 95%, 2-Bromo-6-chlorobenzoyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-bromo-6-chlorobenzoyl chloride (CAS 116529-65-8) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 2-bromo-6-chlorobenzoyl chloride. InChIKey: PXDYMOLKOWSZGA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 2-bromo-6-chlorobenzoyl chloride |
| InChIKey | PXDYMOLKOWSZGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)Cl)Cl |
Computed by PubChem (NCBI)