CAS 943830-31-7 is the registry number for 3-Bromo-2,4-dichlorobenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-2,4-dichlorobenzaldehyde (CAS 943830-31-7) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 3-bromo-2,4-dichlorobenzaldehyde. InChIKey: BLAPYROPARINOZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 3-bromo-2,4-dichlorobenzaldehyde |
| InChIKey | BLAPYROPARINOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Cl)Br)Cl |
Computed by PubChem (NCBI)