CAS 21900-27-6 appears in our catalog under these names: 3-Bromo-5-chlorobenzoyl chloride, 96%, 3-Bromo-5-chlorobenzoyl chloride, ≥95%, 3-Bromo-5-Chlorobenzoyl chloride, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-bromo-5-chlorobenzoyl chloride (CAS 21900-27-6) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 3-bromo-5-chlorobenzoyl chloride. InChIKey: AFMZOCJLKKONRO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 3-bromo-5-chlorobenzoyl chloride |
| InChIKey | AFMZOCJLKKONRO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(=O)Cl |
Computed by PubChem (NCBI)