Products 21900-27-6

CAS 21900-27-6 appears in our catalog under these names: 3-Bromo-5-chlorobenzoyl chloride, 96%, 3-Bromo-5-chlorobenzoyl chloride, ≥95%, 3-Bromo-5-Chlorobenzoyl chloride, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

3-bromo-5-chlorobenzoyl chloride (CAS 21900-27-6) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 3-bromo-5-chlorobenzoyl chloride. InChIKey: AFMZOCJLKKONRO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrCl2O
Molecular weight253.90 g/mol
IUPAC name3-bromo-5-chlorobenzoyl chloride
InChIKeyAFMZOCJLKKONRO-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Br)C(=O)Cl

Computed by PubChem (NCBI)