CAS 1114809-26-5 appears in our catalog under these names: 2-Bromo-3,6-dichlorobenzaldehyde, 95%, 2-Bromo-3,6-dichlorobenzaldehyde, 95+%, 2-Bromo-3,6-dichlorobenzaldehyde, ≥95%, ≥95%, 2-Bromo-3,6-dichlorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-bromo-3,6-dichlorobenzaldehyde (CAS 1114809-26-5) is a chemical compound with the molecular formula C7H3BrCl2O and a molecular weight of 253.90 g/mol. IUPAC name: 2-bromo-3,6-dichlorobenzaldehyde. InChIKey: BBAGMVOYIGEGJC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O |
|---|---|
| Molecular weight | 253.90 g/mol |
| IUPAC name | 2-bromo-3,6-dichlorobenzaldehyde |
| InChIKey | BBAGMVOYIGEGJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C=O)Br)Cl |
Computed by PubChem (NCBI)