cas: 5332-24-1 — see every product listed under this CAS number, including other names
3-Bromoquinoline, 97% (CAS 5332-24-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044937-25G |
| cas | 5332-24-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 96.86 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 100g | 138.51 Pln | |
| Fluorochem | 500g | 471.73 Pln | |
| Fluorochem | 1kg | 888.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-bromoquinoline (CAS 5332-24-1) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 3-bromoquinoline. InChIKey: ZGIKWINFUGEQEO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 3-bromoquinoline |
| InChIKey | ZGIKWINFUGEQEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)Br |
Computed by PubChem (NCBI)