3-Fluoro-2-(trifluoromethyl)isonicotinic acid 98%
cas: 886510-09-4 — see every product listed under this CAS number, including other names
3-Fluoro-2-(trifluoromethyl)isonicotinic acid 98% (CAS 886510-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A395443-100g |
| cas | 886510-09-4 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 14855.12 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1143.56 Pln | |
| Ambeed | 25g | 4686.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A395443 |
3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 886510-09-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: GOYPFNAZTPCXGS-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | GOYPFNAZTPCXGS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)F)C(F)(F)F |
Computed by PubChem (NCBI)