3-Fluoro-2-nitrobenzotrifluoride 95%
cas: 1214335-98-4 — see every product listed under this CAS number, including other names
3-Fluoro-2-nitrobenzotrifluoride 95% (CAS 1214335-98-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362973-100mg |
| cas | 1214335-98-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 2139.25 Pln | |
| Ambeed | 25g | 7312.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A362973 |
1-fluoro-2-nitro-3-(trifluoromethyl)benzene (CAS 1214335-98-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-3-(trifluoromethyl)benzene. InChIKey: GZNQDXJGTLXDGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-3-(trifluoromethyl)benzene |
| InChIKey | GZNQDXJGTLXDGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)