3-Fluoro-4-(trifluoromethyl)benzyl chloride, 95%
cas: 444915-54-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-(trifluoromethyl)benzyl chloride, 95% (CAS 444915-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F865419-250MG |
| cas | 444915-54-2 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 10g | 832.06 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 558.80 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 553.16 Pln | |
| BLDpharm | 10g | 969.68 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-(chloromethyl)-2-fluoro-1-(trifluoromethyl)benzene (CAS 444915-54-2) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 4-(chloromethyl)-2-fluoro-1-(trifluoromethyl)benzene. InChIKey: LBRMEGUZSFQNIT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 4-(chloromethyl)-2-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | LBRMEGUZSFQNIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCl)F)C(F)(F)F |
Computed by PubChem (NCBI)