CAS 444915-54-2 appears in our catalog under these names: 3-Fluoro-4-(trifluoromethyl)benzyl chloride, 95%, 95%, 3-Fluoro-4-(trifluoromethyl)benzyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-(chloromethyl)-2-fluoro-1-(trifluoromethyl)benzene (CAS 444915-54-2) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 4-(chloromethyl)-2-fluoro-1-(trifluoromethyl)benzene. InChIKey: LBRMEGUZSFQNIT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 4-(chloromethyl)-2-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | LBRMEGUZSFQNIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCl)F)C(F)(F)F |
Computed by PubChem (NCBI)