cas: 1026796-69-9 — see every product listed under this CAS number, including other names
3-Fluoro-5-(2,2,2-trifluoroethoxy)phenol 97% (CAS 1026796-69-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A807202-100mg |
| cas | 1026796-69-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 1482.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A807202 |
3-fluoro-5-(2,2,2-trifluoroethoxy)phenol (CAS 1026796-69-9) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 3-fluoro-5-(2,2,2-trifluoroethoxy)phenol. InChIKey: JSJFHYLGFURTCY-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 3-fluoro-5-(2,2,2-trifluoroethoxy)phenol |
| InChIKey | JSJFHYLGFURTCY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OCC(F)(F)F)F)O |
Computed by PubChem (NCBI)