CAS 1360953-77-0 appears in our catalog under these names: 3-Iodo-1h-indole-7-carboxylic acid, 97%, 3-Iodo-1H-indole-7-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
3-iodo-1H-indole-7-carboxylic acid (CAS 1360953-77-0) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 3-iodo-1H-indole-7-carboxylic acid. InChIKey: XPFPSGUINDMCAV-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 3-iodo-1H-indole-7-carboxylic acid |
| InChIKey | XPFPSGUINDMCAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC=C2I |
Computed by PubChem (NCBI)