8-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%
cas: 34954-65-9 — see every product listed under this CAS number, including other names
8-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98% (CAS 34954-65-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A805527-250mg |
| cas | 34954-65-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1349.38 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1154.00 Pln | |
| Chemat | 10g | 1974.80 Pln | |
| Chemat | 25g | 3933.20 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1452.85 Pln | |
| BLDpharm | 25g | 6967.57 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
8-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 34954-65-9) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 8-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: ZPTOZGCACQWXJX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 8-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | ZPTOZGCACQWXJX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1NC(=O)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
3-Methoxy-isatoic anhydride, 8-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 3-methoxyisatoic anhydride, 8-methoxy-1H-3,1-benzoxazine-2,4-dione, 8-methoxy-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 8-methoxyisatoic anhydride, ZPTOZGCACQWXJX-UHFFFAOYSA-N, REF DUPL: 3-Methoxy-isatoic anhydride, 3-Methoxy-isatoic anhydride, CAS 34954-65-9
