CAS 10130-74-2 appears in our catalog under these names: 3-Methoxybenzenesulfonyl chloride, 97% , 3-METHOXYBENZENESULFONYL CHLORIDE, 96%, 3-Methoxybenzenesulfonyl chloride, 97%. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
3-methoxybenzenesulfonyl chloride (CAS 10130-74-2) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 3-methoxybenzenesulfonyl chloride. InChIKey: JHJKSEKUZNJKGO-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 3-methoxybenzenesulfonyl chloride |
| InChIKey | JHJKSEKUZNJKGO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)