CAS 98-68-0 appears in our catalog under these names: 4-Methoxybenzenesulfonyl chloride, 98+% , 4-Methoxybenzene-1-sulfonyl chloride 98%, 4-Methoxybenzenesulfonyl Chloride, 4-Methoxybenzenesulfonyl Chloride, >98.0%(GC)(T), 4-Methoxybenzenesulfonyl chloride, 99%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, TRC, Biosynth, TCI. Available pack sizes: 25g, 100g, 500g , 5g, 10g, 500g, 50g, 0,05kg.
4-methoxybenzenesulfonyl chloride (CAS 98-68-0) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 4-methoxybenzenesulfonyl chloride. InChIKey: DTJVECUKADWGMO-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-methoxybenzenesulfonyl chloride |
| InChIKey | DTJVECUKADWGMO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)