Products 181063-65-0

CAS 181063-65-0 is the registry number for methyl 5-chloro-3-methoxythiophene-2-carboxylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-chloro-3-methoxythiophene-2-carboxylate (CAS 181063-65-0) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: methyl 5-chloro-3-methoxythiophene-2-carboxylate. InChIKey: LXUUJYCERAHOTH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO3S
Molecular weight206.65 g/mol
IUPAC namemethyl 5-chloro-3-methoxythiophene-2-carboxylate
InChIKeyLXUUJYCERAHOTH-UHFFFAOYSA-N
SMILESCOC1=C(SC(=C1)Cl)C(=O)OC

Computed by PubChem (NCBI)