Products 926219-97-8

CAS 926219-97-8 is the registry number for 2-Hydroxy-5-methylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-hydroxy-5-methylbenzenesulfonyl chloride (CAS 926219-97-8) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 2-hydroxy-5-methylbenzenesulfonyl chloride. InChIKey: XZKHPHOPDHZLLU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO3S
Molecular weight206.65 g/mol
IUPAC name2-hydroxy-5-methylbenzenesulfonyl chloride
InChIKeyXZKHPHOPDHZLLU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)O)S(=O)(=O)Cl

Computed by PubChem (NCBI)