CAS 926219-97-8 is the registry number for 2-Hydroxy-5-methylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-hydroxy-5-methylbenzenesulfonyl chloride (CAS 926219-97-8) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 2-hydroxy-5-methylbenzenesulfonyl chloride. InChIKey: XZKHPHOPDHZLLU-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 2-hydroxy-5-methylbenzenesulfonyl chloride |
| InChIKey | XZKHPHOPDHZLLU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)