CAS 2138104-56-8 appears in our catalog under these names: 5-Cyclopropylfuran-2-sulfonyl chloride, 98%, 5-Cyclopropylfuran-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 0,5g, 50mg.
5-cyclopropylfuran-2-sulfonyl chloride (CAS 2138104-56-8) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 5-cyclopropylfuran-2-sulfonyl chloride. InChIKey: GVJGUTAMYOPVCG-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 5-cyclopropylfuran-2-sulfonyl chloride |
| InChIKey | GVJGUTAMYOPVCG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(O2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)