Products 15481-45-5
CAS 15481-45-5 appears in our catalog under these names: Methyl 4-chlorobenzenesulfonate, 95%, Chlorfenson Impurity 1, Methyl 4-chlorobenzenesulfonate, 98%, Methyl 4–chlorobenzenesulfonate, Methyl 4-chlorobenzenesulfonate. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, on request, 100mg, 5g, 10g, 500mg.
Methyl 4-chlorobenzenesulfonate (CAS 15481-45-5) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: methyl 4-chlorobenzenesulfonate. InChIKey: VQFKYAZZFFNYQV-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | methyl 4-chlorobenzenesulfonate |
| InChIKey | VQFKYAZZFFNYQV-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)