CAS 1394917-69-1 is the registry number for 4-Hydroxybenzenemethanesulfonyl Chloride. Offered by: TRC. Available pack sizes: 100mg.
(4-hydroxyphenyl)methanesulfonyl chloride (CAS 1394917-69-1) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: (4-hydroxyphenyl)methanesulfonyl chloride. InChIKey: FGGMBZIWQSGUAK-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | (4-hydroxyphenyl)methanesulfonyl chloride |
| InChIKey | FGGMBZIWQSGUAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)O |
Computed by PubChem (NCBI)