CAS 56773-30-9 appears in our catalog under these names: 4-((Chloromethyl)sulfonyl)phenol 95%, 4-((Chloromethyl)sulfonyl)phenol, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(chloromethylsulfonyl)phenol (CAS 56773-30-9) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 4-(chloromethylsulfonyl)phenol. InChIKey: VAWDBQGXASBCNW-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-(chloromethylsulfonyl)phenol |
| InChIKey | VAWDBQGXASBCNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)S(=O)(=O)CCl |
Computed by PubChem (NCBI)